C25H30N8O3 — CID 170450800
(1E,3E)-1-[1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]piperidin-4-yl]oxy-4-methoxybuta-1,3-diene-1,4-diamine (PubChem CID 170450800) has the molecular formula C25H30N8O3 and a molecular weight of 490.57 g/mol. Its IUPAC name is (1E,3E)-1-[1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]piperidin-4-yl]oxy-4-methoxybuta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3E)-1-[1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]piperidin-4-yl]oxy-4-methoxybuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 170450800 |
| Molecular Formula | C25H30N8O3 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (1E,3E)-1-[1-[5-(10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaen-12-yl)-2-pyridinyl]piperidin-4-yl]oxy-4-methoxybuta-1,3-diene-1,4-diamine |
| SMILES | CCOc1cc(-c2ccc(N3CCC(O/C(N)=C/C=C(\N)OC)CC3)nc2)c2c3cn[nH]c3nn2c1 |
| InChI | InChI=1S/C25H30N8O3/c1-3-35-18-12-19(24-20-14-29-30-25(20)31-33(24)15-18)16-4-7-23(28-13-16)32-10-8-17(9-11-32)36-22(27)6-5-21(26)34-2/h4-7,12-15,17H,3,8-11,26-27H2,1-2H3,(H,30,31)/b21-5+,22-6+ |
| InChIKey | ASHOXRODGFSAET-OXAZHYLESA-N |
| XLogP | 2.90 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|