C16H31NO — CID 142327682
ethane;N-methyl-2-(3-propylphenoxy)ethanamine (PubChem CID 142327682) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;N-methyl-2-(3-propylphenoxy)ethanamine.
| Compound Name | ethane;N-methyl-2-(3-propylphenoxy)ethanamine |
|---|---|
| PubChem CID | 142327682 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | ethane;N-methyl-2-(3-propylphenoxy)ethanamine |
| SMILES | CC.CC.CCCc1cccc(OCCNC)c1 |
| InChI | InChI=1S/C12H19NO.2C2H6/c1-3-5-11-6-4-7-12(10-11)14-9-8-13-2;2*1-2/h4,6-7,10,13H,3,5,8-9H2,1-2H3;2*1-2H3 |
| InChIKey | WWYJULRYBNWKFJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|