C34H21N3OS — CID 142328998
2-[5-(furan-2-yl)-9-(3-pyridin-2-ylphenyl)carbazol-2-yl]-1,3-benzothiazole (PubChem CID 142328998) has the molecular formula C34H21N3OS and a molecular weight of 519.63 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-9-(3-pyridin-2-ylphenyl)carbazol-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[5-(furan-2-yl)-9-(3-pyridin-2-ylphenyl)carbazol-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 142328998 |
| Molecular Formula | C34H21N3OS |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 2-[5-(furan-2-yl)-9-(3-pyridin-2-ylphenyl)carbazol-2-yl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2cccc(-n3c4cc(-c5nc6ccccc6s5)ccc4c4c(-c5ccco5)cccc43)c2)nc1 |
| InChI | InChI=1S/C34H21N3OS/c1-2-15-32-28(12-1)36-34(39-32)23-16-17-25-30(21-23)37(24-9-5-8-22(20-24)27-11-3-4-18-35-27)29-13-6-10-26(33(25)29)31-14-7-19-38-31/h1-21H |
| InChIKey | RSPCQZBWLHYUMB-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |