C7H17NO — CID 142330300
N,N-dimethyloxetan-3-amine;ethane (PubChem CID 142330300) has the molecular formula C7H17NO and a molecular weight of 131.22 g/mol. Its IUPAC name is N,N-dimethyloxetan-3-amine;ethane.
| Compound Name | N,N-dimethyloxetan-3-amine;ethane |
|---|---|
| PubChem CID | 142330300 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | N,N-dimethyloxetan-3-amine;ethane |
| SMILES | CC.CN(C)C1COC1 |
| InChI | InChI=1S/C5H11NO.C2H6/c1-6(2)5-3-7-4-5;1-2/h5H,3-4H2,1-2H3;1-2H3 |
| InChIKey | MPEHXFYDPADQTE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |