C26H38O2 — CID 142332635
methyl (Z,5R)-5-[(8R,9S,10R,13R,14S,17R)-13-methyl-3-methylidene-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-2-enoate (PubChem CID 142332635) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is methyl (Z,5R)-5-[(8R,9S,10R,13R,14S,17R)-13-methyl-3-methylidene-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-2-enoate.
| Compound Name | methyl (Z,5R)-5-[(8R,9S,10R,13R,14S,17R)-13-methyl-3-methylidene-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-2-enoate |
|---|---|
| PubChem CID | 142332635 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | methyl (Z,5R)-5-[(8R,9S,10R,13R,14S,17R)-13-methyl-3-methylidene-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hex-2-enoate |
| SMILES | C=C1CC[C@H]2C(=CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)C/C=C\C(=O)OC)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H38O2/c1-17-8-10-20-19(16-17)9-11-22-21(20)14-15-26(3)23(12-13-24(22)26)18(2)6-5-7-25(27)28-4/h5,7,9,18,20-24H,1,6,8,10-16H2,2-4H3/b7-5-/t18-,20+,21-,22-,23-,24+,26-/m1/s1 |
| InChIKey | XLUYRMGNSWSFED-KQXRPJMCSA-N |
| XLogP | 6.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|