C34H54O3S — CID 142333003
17-[3-(benzenesulfonyl)-6,6-dimethylheptyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 142333003) has the molecular formula C34H54O3S and a molecular weight of 542.87 g/mol. Its IUPAC name is 17-[3-(benzenesulfonyl)-6,6-dimethylheptyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-[3-(benzenesulfonyl)-6,6-dimethylheptyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 142333003 |
| Molecular Formula | C34H54O3S |
| Molecular Weight | 542.87 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | 17-[3-(benzenesulfonyl)-6,6-dimethylheptyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)(C)CCC(CCC1CCC2C3CCC4CC(O)CCC4(C)C3CCC12C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H54O3S/c1-32(2,3)20-18-28(38(36,37)27-9-7-6-8-10-27)14-11-24-13-16-30-29-15-12-25-23-26(35)17-21-34(25,5)31(29)19-22-33(24,30)4/h6-10,24-26,28-31,35H,11-23H2,1-5H3 |
| InChIKey | WQMKJXAMXWNHOZ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.87 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |