C29H44O2 — CID 170098332
(10S,13R)-17-(2-hydroxy-4-phenylbutyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 170098332) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is (10S,13R)-17-(2-hydroxy-4-phenylbutyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (10S,13R)-17-(2-hydroxy-4-phenylbutyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 170098332 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | (10S,13R)-17-(2-hydroxy-4-phenylbutyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CCC(O)CC1CCC1C2CC[C@]2(C)C(CC(O)CCc3ccccc3)CCC12 |
| InChI | InChI=1S/C29H44O2/c1-28-16-14-24(31)19-21(28)9-12-25-26-13-10-22(29(26,2)17-15-27(25)28)18-23(30)11-8-20-6-4-3-5-7-20/h3-7,21-27,30-31H,8-19H2,1-2H3/t21?,22?,23?,24?,25?,26?,27?,28-,29+/m0/s1 |
| InChIKey | JODUMNRHXQFVPV-DZCZYZLYSA-N |
| XLogP | 6.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |