C28H41FO2 — CID 145304043
(8R)-17-[3-(4-fluorophenyl)-1-hydroxypropyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 145304043) has the molecular formula C28H41FO2 and a molecular weight of 428.63 g/mol. Its IUPAC name is (8R)-17-[3-(4-fluorophenyl)-1-hydroxypropyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R)-17-[3-(4-fluorophenyl)-1-hydroxypropyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 145304043 |
| Molecular Formula | C28H41FO2 |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | (8R)-17-[3-(4-fluorophenyl)-1-hydroxypropyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCC(O)CC1CC[C@@H]1C2CCC2(C)C(C(O)CCc3ccc(F)cc3)CCC12 |
| InChI | InChI=1S/C28H41FO2/c1-27-15-13-21(30)17-19(27)6-9-22-23-10-11-25(28(23,2)16-14-24(22)27)26(31)12-5-18-3-7-20(29)8-4-18/h3-4,7-8,19,21-26,30-31H,5-6,9-17H2,1-2H3/t19?,21?,22-,23?,24?,25?,26?,27?,28?/m0/s1 |
| InChIKey | COXGTMRBWBEVTL-FXSBHMCKSA-N |
| XLogP | 6.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |