C28H35N5O3S — CID 142333544
(E)-2-[5-[5-[(dimethylamino)methyl]-3-pyridinyl]-2-methylphenyl]-N-[6-(methanesulfonamido)-3-pyridinyl]hept-2-enamide (PubChem CID 142333544) has the molecular formula C28H35N5O3S and a molecular weight of 521.69 g/mol. Its IUPAC name is (E)-2-[5-[5-[(dimethylamino)methyl]-3-pyridinyl]-2-methylphenyl]-N-[6-(methanesulfonamido)-3-pyridinyl]hept-2-enamide.
| Compound Name | (E)-2-[5-[5-[(dimethylamino)methyl]-3-pyridinyl]-2-methylphenyl]-N-[6-(methanesulfonamido)-3-pyridinyl]hept-2-enamide |
|---|---|
| PubChem CID | 142333544 |
| Molecular Formula | C28H35N5O3S |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | (E)-2-[5-[5-[(dimethylamino)methyl]-3-pyridinyl]-2-methylphenyl]-N-[6-(methanesulfonamido)-3-pyridinyl]hept-2-enamide |
| SMILES | CCCC/C=C(/C(=O)Nc1ccc(NS(C)(=O)=O)nc1)c1cc(-c2cncc(CN(C)C)c2)ccc1C |
| InChI | InChI=1S/C28H35N5O3S/c1-6-7-8-9-25(28(34)31-24-12-13-27(30-18-24)32-37(5,35)36)26-15-22(11-10-20(26)2)23-14-21(16-29-17-23)19-33(3)4/h9-18H,6-8,19H2,1-5H3,(H,30,32)(H,31,34)/b25-9+ |
| InChIKey | XTTQBGOSSYUVCM-YCPBAFNGSA-N |
| XLogP | 5.10 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|