C27H31N7O2 — CID 166774366
N-[5-[4-amino-3-[3-[[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]amino]-3-oxoprop-1-en-2-yl]phenyl]-3-pyridinyl]cyclopropanecarboxamide (PubChem CID 166774366) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[5-[4-amino-3-[3-[[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]amino]-3-oxoprop-1-en-2-yl]phenyl]-3-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[5-[4-amino-3-[3-[[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]amino]-3-oxoprop-1-en-2-yl]phenyl]-3-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 166774366 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | N-[5-[4-amino-3-[3-[[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]amino]-3-oxoprop-1-en-2-yl]phenyl]-3-pyridinyl]cyclopropanecarboxamide |
| SMILES | C=C(C(=O)Nc1ccc(NCCN(C)C)nc1)c1cc(-c2cncc(NC(=O)C3CC3)c2)ccc1N |
| InChI | InChI=1S/C27H31N7O2/c1-17(26(35)32-21-7-9-25(31-16-21)30-10-11-34(2)3)23-13-19(6-8-24(23)28)20-12-22(15-29-14-20)33-27(36)18-4-5-18/h6-9,12-16,18H,1,4-5,10-11,28H2,2-3H3,(H,30,31)(H,32,35)(H,33,36) |
| InChIKey | YIZAUWWTCWGJJV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|