C31H34F2N6O2 — CID 166774319
5-[2-[2-amino-5-[5-[(4,4-difluoropiperidin-1-yl)methyl]-3-pyridinyl]phenyl]prop-2-enoylamino]-N-cyclopentylpyridine-2-carboxamide (PubChem CID 166774319) has the molecular formula C31H34F2N6O2 and a molecular weight of 560.65 g/mol. Its IUPAC name is 5-[2-[2-amino-5-[5-[(4,4-difluoropiperidin-1-yl)methyl]-3-pyridinyl]phenyl]prop-2-enoylamino]-N-cyclopentylpyridine-2-carboxamide.
| Compound Name | 5-[2-[2-amino-5-[5-[(4,4-difluoropiperidin-1-yl)methyl]-3-pyridinyl]phenyl]prop-2-enoylamino]-N-cyclopentylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 166774319 |
| Molecular Formula | C31H34F2N6O2 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 5-[2-[2-amino-5-[5-[(4,4-difluoropiperidin-1-yl)methyl]-3-pyridinyl]phenyl]prop-2-enoylamino]-N-cyclopentylpyridine-2-carboxamide |
| SMILES | C=C(C(=O)Nc1ccc(C(=O)NC2CCCC2)nc1)c1cc(-c2cncc(CN3CCC(F)(F)CC3)c2)ccc1N |
| InChI | InChI=1S/C31H34F2N6O2/c1-20(29(40)38-25-7-9-28(36-18-25)30(41)37-24-4-2-3-5-24)26-15-22(6-8-27(26)34)23-14-21(16-35-17-23)19-39-12-10-31(32,33)11-13-39/h6-9,14-18,24H,1-5,10-13,19,34H2,(H,37,41)(H,38,40) |
| InChIKey | NSPYBYGIGCXLBV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|