C30H36N6O2 — CID 123585940
2-[2-amino-5-[5-(morpholin-4-ylmethyl)-3-pyridinyl]phenyl]-N-(6-cycloheptyl-3-pyridinyl)-2-iminoacetamide (PubChem CID 123585940) has the molecular formula C30H36N6O2 and a molecular weight of 512.66 g/mol. Its IUPAC name is 2-[2-amino-5-[5-(morpholin-4-ylmethyl)-3-pyridinyl]phenyl]-N-(6-cycloheptyl-3-pyridinyl)-2-iminoacetamide.
| Compound Name | 2-[2-amino-5-[5-(morpholin-4-ylmethyl)-3-pyridinyl]phenyl]-N-(6-cycloheptyl-3-pyridinyl)-2-iminoacetamide |
|---|---|
| PubChem CID | 123585940 |
| Molecular Formula | C30H36N6O2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 2-[2-amino-5-[5-(morpholin-4-ylmethyl)-3-pyridinyl]phenyl]-N-(6-cycloheptyl-3-pyridinyl)-2-iminoacetamide |
| SMILES | [H]/N=C(/C(=O)Nc1ccc(C2CCCCCC2)nc1)c1cc(-c2cncc(CN3CCOCC3)c2)ccc1N |
| InChI | InChI=1S/C30H36N6O2/c31-27-9-7-23(24-15-21(17-33-18-24)20-36-11-13-38-14-12-36)16-26(27)29(32)30(37)35-25-8-10-28(34-19-25)22-5-3-1-2-4-6-22/h7-10,15-19,22,32H,1-6,11-14,20,31H2,(H,35,37)/b32-29+ |
| InChIKey | VLXDBRRSEILHFO-UUDCSCGESA-N |
| XLogP | 5.00 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|