C22H21F2N7O — CID 123235386
2-[2-amino-5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]phenyl]-2-imino-N-pyrazin-2-ylacetamide (PubChem CID 123235386) has the molecular formula C22H21F2N7O and a molecular weight of 437.45 g/mol. Its IUPAC name is 2-[2-amino-5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]phenyl]-2-imino-N-pyrazin-2-ylacetamide.
| Compound Name | 2-[2-amino-5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]phenyl]-2-imino-N-pyrazin-2-ylacetamide |
|---|---|
| PubChem CID | 123235386 |
| Molecular Formula | C22H21F2N7O |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-[2-amino-5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]phenyl]-2-imino-N-pyrazin-2-ylacetamide |
| SMILES | [H]/N=C(\C(=O)Nc1cnccn1)c1cc(-c2cncc(CN3CCC(F)(F)C3)c2)ccc1N |
| InChI | InChI=1S/C22H21F2N7O/c23-22(24)3-6-31(13-22)12-14-7-16(10-28-9-14)15-1-2-18(25)17(8-15)20(26)21(32)30-19-11-27-4-5-29-19/h1-2,4-5,7-11,26H,3,6,12-13,25H2,(H,29,30,32)/b26-20- |
| InChIKey | AUNHZTKEGYHZHU-QOMWVZHYSA-N |
| XLogP | 2.97 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|