C26H26F3N5O — CID 123383091
2-[2-amino-5-[5-(piperidin-1-ylmethyl)-3-pyridinyl]phenyl]-N-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enamide (PubChem CID 123383091) has the molecular formula C26H26F3N5O and a molecular weight of 481.52 g/mol. Its IUPAC name is 2-[2-amino-5-[5-(piperidin-1-ylmethyl)-3-pyridinyl]phenyl]-N-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enamide.
| Compound Name | 2-[2-amino-5-[5-(piperidin-1-ylmethyl)-3-pyridinyl]phenyl]-N-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 123383091 |
| Molecular Formula | C26H26F3N5O |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[2-amino-5-[5-(piperidin-1-ylmethyl)-3-pyridinyl]phenyl]-N-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enamide |
| SMILES | C=C(C(=O)Nc1ccc(C(F)(F)F)cn1)c1cc(-c2cncc(CN3CCCCC3)c2)ccc1N |
| InChI | InChI=1S/C26H26F3N5O/c1-17(25(35)33-24-8-6-21(15-32-24)26(27,28)29)22-12-19(5-7-23(22)30)20-11-18(13-31-14-20)16-34-9-3-2-4-10-34/h5-8,11-15H,1-4,9-10,16,30H2,(H,32,33,35) |
| InChIKey | COHPXWXKMSWBCZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|