C38H46F3N3 — CID 142333745
(2E,4Z)-N-[3-[5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]-2-methylphenyl]buta-1,3-dien-2-yl]-6-[(2-fluorophenyl)methyl]hepta-2,4,6-trien-3-amine;ethane;methane (PubChem CID 142333745) has the molecular formula C38H46F3N3 and a molecular weight of 601.80 g/mol. Its IUPAC name is (2E,4Z)-N-[3-[5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]-2-methylphenyl]buta-1,3-dien-2-yl]-6-[(2-fluorophenyl)methyl]hepta-2,4,6-trien-3-amine;ethane;methane.
| Compound Name | (2E,4Z)-N-[3-[5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]-2-methylphenyl]buta-1,3-dien-2-yl]-6-[(2-fluorophenyl)methyl]hepta-2,4,6-trien-3-amine;ethane;methane |
|---|---|
| PubChem CID | 142333745 |
| Molecular Formula | C38H46F3N3 |
| Molecular Weight | 601.80 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | (2E,4Z)-N-[3-[5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]-2-methylphenyl]buta-1,3-dien-2-yl]-6-[(2-fluorophenyl)methyl]hepta-2,4,6-trien-3-amine;ethane;methane |
| SMILES | C.C=C(/C=C\C(=C/C)NC(=C)C(=C)c1cc(-c2cncc(CN3CCC(F)(F)C3)c2)ccc1C)Cc1ccccc1F.CC |
| InChI | InChI=1S/C35H36F3N3.C2H6.CH4/c1-6-32(14-11-24(2)17-30-9-7-8-10-34(30)36)40-27(5)26(4)33-19-29(13-12-25(33)3)31-18-28(20-39-21-31)22-41-16-15-35(37,38)23-41;1-2;/h6-14,18-21,40H,2,4-5,15-17,22-23H2,1,3H3;1-2H3;1H4/b14-11-,32-6+;; |
| InChIKey | MRFOCVJQXQJOQI-WEMYFMLMSA-N |
| XLogP | 10.07 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.80 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|