C8H15N3 — CID 142334326
ethane;6-propan-2-yl-1,2,4-triazine (PubChem CID 142334326) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is ethane;6-propan-2-yl-1,2,4-triazine.
| Compound Name | ethane;6-propan-2-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 142334326 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | ethane;6-propan-2-yl-1,2,4-triazine |
| SMILES | CC.CC(C)c1cncnn1 |
| InChI | InChI=1S/C6H9N3.C2H6/c1-5(2)6-3-7-4-8-9-6;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | SXIVEXGJCVSDIY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |