C18H32N4 — CID 160766869
ethane;4-propan-2-ylpyrimidine;5-propan-2-ylpyrimidine (PubChem CID 160766869) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is ethane;4-propan-2-ylpyrimidine;5-propan-2-ylpyrimidine.
| Compound Name | ethane;4-propan-2-ylpyrimidine;5-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 160766869 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | ethane;4-propan-2-ylpyrimidine;5-propan-2-ylpyrimidine |
| SMILES | CC.CC.CC(C)c1ccncn1.CC(C)c1cncnc1 |
| InChI | InChI=1S/2C7H10N2.2C2H6/c1-6(2)7-3-8-5-9-4-7;1-6(2)7-3-4-8-5-9-7;2*1-2/h2*3-6H,1-2H3;2*1-2H3 |
| InChIKey | RYUGSSALEFCYAD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |