C14H18N2OS2 — CID 142334465
4-[5-(3-methoxypropyl)-1,3-thiazol-2-yl]-2-methylsulfanylaniline (PubChem CID 142334465) has the molecular formula C14H18N2OS2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 4-[5-(3-methoxypropyl)-1,3-thiazol-2-yl]-2-methylsulfanylaniline.
| Compound Name | 4-[5-(3-methoxypropyl)-1,3-thiazol-2-yl]-2-methylsulfanylaniline |
|---|---|
| PubChem CID | 142334465 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-[5-(3-methoxypropyl)-1,3-thiazol-2-yl]-2-methylsulfanylaniline |
| SMILES | COCCCc1cnc(-c2ccc(N)c(SC)c2)s1 |
| InChI | InChI=1S/C14H18N2OS2/c1-17-7-3-4-11-9-16-14(19-11)10-5-6-12(15)13(8-10)18-2/h5-6,8-9H,3-4,7,15H2,1-2H3 |
| InChIKey | ZABHGJDLZWIMEX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|