C21H26ClIN7OPS — CID 142334862
N-[2-[(5-chloro-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl)amino]-5-(1-methylpyrazol-4-yl)phenyl]-N-methylmethanesulfinamide;ethane (PubChem CID 142334862) has the molecular formula C21H26ClIN7OPS and a molecular weight of 617.88 g/mol. Its IUPAC name is N-[2-[(5-chloro-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl)amino]-5-(1-methylpyrazol-4-yl)phenyl]-N-methylmethanesulfinamide;ethane.
| Compound Name | N-[2-[(5-chloro-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl)amino]-5-(1-methylpyrazol-4-yl)phenyl]-N-methylmethanesulfinamide;ethane |
|---|---|
| PubChem CID | 142334862 |
| Molecular Formula | C21H26ClIN7OPS |
| Molecular Weight | 617.88 g/mol |
| Exact Mass | 617.04 |
| IUPAC Name | N-[2-[(5-chloro-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl)amino]-5-(1-methylpyrazol-4-yl)phenyl]-N-methylmethanesulfinamide;ethane |
| SMILES | CC.Cc1nc2c(Nc3ccc(-c4cnn(C)c4)cc3N(C)S(C)=O)cc(Cl)nc2n1PI |
| InChI | InChI=1S/C19H20ClIN7OPS.C2H6/c1-11-23-18-15(8-17(20)25-19(18)28(11)30-21)24-14-6-5-12(13-9-22-26(2)10-13)7-16(14)27(3)31(4)29;1-2/h5-10,30H,1-4H3,(H,24,25);1-2H3 |
| InChIKey | GMQYNCSBVIFIOP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.88 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|