C17H32O4Si — CID 142335977
ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-(2-oxoethyl)cyclohexane-1-carboxylate (PubChem CID 142335977) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-(2-oxoethyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-(2-oxoethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 142335977 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-1-(2-oxoethyl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(CC=O)CCC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H32O4Si/c1-7-20-15(19)17(12-13-18)10-8-14(9-11-17)21-22(5,6)16(2,3)4/h13-14H,7-12H2,1-6H3 |
| InChIKey | IESINEAAKJWKRD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|