About cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate
cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate (PubChem CID 142337689) has the molecular formula C15H21FO3
and a molecular weight of 268.33 g/mol. Its IUPAC name is cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate.
Molecular Properties
| Compound Name | cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate |
| PubChem CID | 142337689 |
| Molecular Formula | C15H21FO3 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate |
| SMILES | C1CC1.COC(=O)C(C)(F)Cc1cccc(CO)c1 |
| InChI | InChI=1S/C12H15FO3.C3H6/c1-12(13,11(15)16-2)7-9-4-3-5-10(6-9)8-14;1-2-3-1/h3-6,14H,7-8H2,1-2H3;1-3H2 |
| InChIKey | NQNPWZHUXHCFPT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate?
The IUPAC name of cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate (CID 142337689) is cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate.
What is the SMILES notation for cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate?
The canonical SMILES for cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate is C1CC1.COC(=O)C(C)(F)Cc1cccc(CO)c1.
What is the InChIKey of cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate?
The InChIKey is NQNPWZHUXHCFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO3.C3H6/c1-12(13,11(15)16-2)7-9-4-3-5-10(6-9)8-14;1-2-3-1/h3-6,14H,7-8H2,1-2H3;1-3H2.
What are the key properties of cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate?
cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate has a molecular weight of 268.33 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;methyl 2-fluoro-3-[3-(hydroxymethyl)phenyl]-2-methylpropanoate is sourced from PubChem (CID 142337689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).