C10H13FN2O — CID 142338940
3,4-dihydro-2H-pyrrole;5-fluoro-2-methoxypyridine (PubChem CID 142338940) has the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrrole;5-fluoro-2-methoxypyridine.
| Compound Name | 3,4-dihydro-2H-pyrrole;5-fluoro-2-methoxypyridine |
|---|---|
| PubChem CID | 142338940 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 3,4-dihydro-2H-pyrrole;5-fluoro-2-methoxypyridine |
| SMILES | C1=NCCC1.COc1ccc(F)cn1 |
| InChI | InChI=1S/C6H6FNO.C4H7N/c1-9-6-3-2-5(7)4-8-6;1-2-4-5-3-1/h2-4H,1H3;3H,1-2,4H2 |
| InChIKey | QFWRSVOWWZHKRY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |