(5-fluoro-2-pyridinyl)oxyboronic acid

C5H5BFNO3 — CID 142768845

IUPAC(5-fluoro-2-pyridinyl)oxyboronic acid
SMILESOB(O)Oc1ccc(F)cn1
InChIInChI=1S/C5H5BFNO3/c7-4-1-2-5(8-3-4)11-6(9)10/h1-3,9-10H
InChIKeyFSDYLRXMQQJWQA-UHFFFAOYSA-N
MW156.91 g/mol
LogP-0.43
Rot. Bonds2

About (5-fluoro-2-pyridinyl)oxyboronic acid

(5-fluoro-2-pyridinyl)oxyboronic acid (PubChem CID 142768845) has the molecular formula C5H5BFNO3 and a molecular weight of 156.91 g/mol. Its IUPAC name is (5-fluoro-2-pyridinyl)oxyboronic acid.

Molecular Properties

Compound Name(5-fluoro-2-pyridinyl)oxyboronic acid
PubChem CID142768845
Molecular FormulaC5H5BFNO3
Molecular Weight156.91 g/mol
Exact Mass157.03
IUPAC Name(5-fluoro-2-pyridinyl)oxyboronic acid
SMILESOB(O)Oc1ccc(F)cn1
InChIInChI=1S/C5H5BFNO3/c7-4-1-2-5(8-3-4)11-6(9)10/h1-3,9-10H
InChIKeyFSDYLRXMQQJWQA-UHFFFAOYSA-N
XLogP-0.43
TPSA62.58 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.91
LogP ≤ 5-0.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5-fluoro-2-pyridinyl)oxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-fluoro-2-pyridinyl)oxyboronic acid?
The IUPAC name of (5-fluoro-2-pyridinyl)oxyboronic acid (CID 142768845) is (5-fluoro-2-pyridinyl)oxyboronic acid.
What is the SMILES notation for (5-fluoro-2-pyridinyl)oxyboronic acid?
The canonical SMILES for (5-fluoro-2-pyridinyl)oxyboronic acid is OB(O)Oc1ccc(F)cn1.
What is the InChIKey of (5-fluoro-2-pyridinyl)oxyboronic acid?
The InChIKey is FSDYLRXMQQJWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BFNO3/c7-4-1-2-5(8-3-4)11-6(9)10/h1-3,9-10H.
What are the key properties of (5-fluoro-2-pyridinyl)oxyboronic acid?
(5-fluoro-2-pyridinyl)oxyboronic acid has a molecular weight of 156.91 g/mol, XLogP of -0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2-pyridinyl)oxyboronic acid is sourced from PubChem (CID 142768845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).