About 5-fluoro-2-methylpyridine;methanol;hydrochloride
5-fluoro-2-methylpyridine;methanol;hydrochloride (PubChem CID 142285240) has the molecular formula C7H11ClFNO
and a molecular weight of 179.62 g/mol. Its IUPAC name is 5-fluoro-2-methylpyridine;methanol;hydrochloride.
Molecular Properties
| Compound Name | 5-fluoro-2-methylpyridine;methanol;hydrochloride |
| PubChem CID | 142285240 |
| Molecular Formula | C7H11ClFNO |
| Molecular Weight | 179.62 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 5-fluoro-2-methylpyridine;methanol;hydrochloride |
| SMILES | CO.Cc1ccc(F)cn1.Cl |
| InChI | InChI=1S/C6H6FN.CH4O.ClH/c1-5-2-3-6(7)4-8-5;1-2;/h2-4H,1H3;2H,1H3;1H |
| InChIKey | OIAYXQIRLCBTMD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.62 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2-methylpyridine;methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methylpyridine;methanol;hydrochloride?
The IUPAC name of 5-fluoro-2-methylpyridine;methanol;hydrochloride (CID 142285240) is 5-fluoro-2-methylpyridine;methanol;hydrochloride.
What is the SMILES notation for 5-fluoro-2-methylpyridine;methanol;hydrochloride?
The canonical SMILES for 5-fluoro-2-methylpyridine;methanol;hydrochloride is CO.Cc1ccc(F)cn1.Cl.
What is the InChIKey of 5-fluoro-2-methylpyridine;methanol;hydrochloride?
The InChIKey is OIAYXQIRLCBTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN.CH4O.ClH/c1-5-2-3-6(7)4-8-5;1-2;/h2-4H,1H3;2H,1H3;1H.
What are the key properties of 5-fluoro-2-methylpyridine;methanol;hydrochloride?
5-fluoro-2-methylpyridine;methanol;hydrochloride has a molecular weight of 179.62 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methylpyridine;methanol;hydrochloride is sourced from PubChem (CID 142285240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).