About 5-fluoro-2-methylpyridine;4-methylheptane
5-fluoro-2-methylpyridine;4-methylheptane (PubChem CID 144860351) has the molecular formula C14H24FN
and a molecular weight of 225.35 g/mol. Its IUPAC name is 5-fluoro-2-methylpyridine;4-methylheptane.
Molecular Properties
| Compound Name | 5-fluoro-2-methylpyridine;4-methylheptane |
| PubChem CID | 144860351 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | 5-fluoro-2-methylpyridine;4-methylheptane |
| SMILES | CCCC(C)CCC.Cc1ccc(F)cn1 |
| InChI | InChI=1S/C8H18.C6H6FN/c1-4-6-8(3)7-5-2;1-5-2-3-6(7)4-8-5/h8H,4-7H2,1-3H3;2-4H,1H3 |
| InChIKey | DDGLYGXDHKOIML-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-2-methylpyridine;4-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methylpyridine;4-methylheptane?
The IUPAC name of 5-fluoro-2-methylpyridine;4-methylheptane (CID 144860351) is 5-fluoro-2-methylpyridine;4-methylheptane.
What is the SMILES notation for 5-fluoro-2-methylpyridine;4-methylheptane?
The canonical SMILES for 5-fluoro-2-methylpyridine;4-methylheptane is CCCC(C)CCC.Cc1ccc(F)cn1.
What is the InChIKey of 5-fluoro-2-methylpyridine;4-methylheptane?
The InChIKey is DDGLYGXDHKOIML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C6H6FN/c1-4-6-8(3)7-5-2;1-5-2-3-6(7)4-8-5/h8H,4-7H2,1-3H3;2-4H,1H3.
What are the key properties of 5-fluoro-2-methylpyridine;4-methylheptane?
5-fluoro-2-methylpyridine;4-methylheptane has a molecular weight of 225.35 g/mol, XLogP of 4.75, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methylpyridine;4-methylheptane is sourced from PubChem (CID 144860351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).