About 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine
5-fluoro-2-methylpyridine;6-methylpyridin-3-amine (PubChem CID 158536095) has the molecular formula C12H14FN3
and a molecular weight of 219.26 g/mol. Its IUPAC name is 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine.
Molecular Properties
| Compound Name | 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine |
| PubChem CID | 158536095 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine |
| SMILES | Cc1ccc(F)cn1.Cc1ccc(N)cn1 |
| InChI | InChI=1S/C6H6FN.C6H8N2/c2*1-5-2-3-6(7)4-8-5/h2-4H,1H3;2-4H,7H2,1H3 |
| InChIKey | HNYPAMUIRUNCET-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine?
The IUPAC name of 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine (CID 158536095) is 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine.
What is the SMILES notation for 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine?
The canonical SMILES for 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine is Cc1ccc(F)cn1.Cc1ccc(N)cn1.
What is the InChIKey of 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine?
The InChIKey is HNYPAMUIRUNCET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN.C6H8N2/c2*1-5-2-3-6(7)4-8-5/h2-4H,1H3;2-4H,7H2,1H3.
What are the key properties of 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine?
5-fluoro-2-methylpyridine;6-methylpyridin-3-amine has a molecular weight of 219.26 g/mol, XLogP of 2.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methylpyridine;6-methylpyridin-3-amine is sourced from PubChem (CID 158536095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).