C18H16N6O3 — CID 142338970
4-oxa-2,15,19,20,23,25-hexazapentacyclo[15.5.2.17,11.02,6.020,24]pentacosa-1(23),7,9,11(25),17(24),18,21-heptaene-3,16-dione (PubChem CID 142338970) has the molecular formula C18H16N6O3 and a molecular weight of 364.37 g/mol. Its IUPAC name is 4-oxa-2,15,19,20,23,25-hexazapentacyclo[15.5.2.17,11.02,6.020,24]pentacosa-1(23),7,9,11(25),17(24),18,21-heptaene-3,16-dione.
| Compound Name | 4-oxa-2,15,19,20,23,25-hexazapentacyclo[15.5.2.17,11.02,6.020,24]pentacosa-1(23),7,9,11(25),17(24),18,21-heptaene-3,16-dione |
|---|---|
| PubChem CID | 142338970 |
| Molecular Formula | C18H16N6O3 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-oxa-2,15,19,20,23,25-hexazapentacyclo[15.5.2.17,11.02,6.020,24]pentacosa-1(23),7,9,11(25),17(24),18,21-heptaene-3,16-dione |
| SMILES | O=C1NCCCc2cccc(n2)C2COC(=O)N2c2ccn3ncc1c3n2 |
| InChI | InChI=1S/C18H16N6O3/c25-17-12-9-20-23-8-6-15(22-16(12)23)24-14(10-27-18(24)26)13-5-1-3-11(21-13)4-2-7-19-17/h1,3,5-6,8-9,14H,2,4,7,10H2,(H,19,25) |
| InChIKey | JYWWMLCORVWOGP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |