C19H17FN6O3 — CID 142338953
9-fluoro-4-oxa-2,16,20,21,24,26-hexazapentacyclo[16.5.2.17,11.02,6.021,25]hexacosa-1(24),7,9,11(26),18(25),19,22-heptaene-3,17-dione (PubChem CID 142338953) has the molecular formula C19H17FN6O3 and a molecular weight of 396.38 g/mol. Its IUPAC name is 9-fluoro-4-oxa-2,16,20,21,24,26-hexazapentacyclo[16.5.2.17,11.02,6.021,25]hexacosa-1(24),7,9,11(26),18(25),19,22-heptaene-3,17-dione.
| Compound Name | 9-fluoro-4-oxa-2,16,20,21,24,26-hexazapentacyclo[16.5.2.17,11.02,6.021,25]hexacosa-1(24),7,9,11(26),18(25),19,22-heptaene-3,17-dione |
|---|---|
| PubChem CID | 142338953 |
| Molecular Formula | C19H17FN6O3 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 9-fluoro-4-oxa-2,16,20,21,24,26-hexazapentacyclo[16.5.2.17,11.02,6.021,25]hexacosa-1(24),7,9,11(26),18(25),19,22-heptaene-3,17-dione |
| SMILES | O=C1NCCCCc2cc(F)cc(n2)C2COC(=O)N2c2ccn3ncc1c3n2 |
| InChI | InChI=1S/C19H17FN6O3/c20-11-7-12-3-1-2-5-21-18(27)13-9-22-25-6-4-16(24-17(13)25)26-15(10-29-19(26)28)14(8-11)23-12/h4,6-9,15H,1-3,5,10H2,(H,21,27) |
| InChIKey | VYZNDNJHSIXOPD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |