C20H21FN6O — CID 134468698
9-fluoro-14-methyl-2,15,19,20,23,25-hexazapentacyclo[15.5.2.17,11.02,6.020,24]pentacosa-1(23),7,9,11(25),17(24),18,21-heptaen-16-one (PubChem CID 134468698) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is 9-fluoro-14-methyl-2,15,19,20,23,25-hexazapentacyclo[15.5.2.17,11.02,6.020,24]pentacosa-1(23),7,9,11(25),17(24),18,21-heptaen-16-one.
| Compound Name | 9-fluoro-14-methyl-2,15,19,20,23,25-hexazapentacyclo[15.5.2.17,11.02,6.020,24]pentacosa-1(23),7,9,11(25),17(24),18,21-heptaen-16-one |
|---|---|
| PubChem CID | 134468698 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 9-fluoro-14-methyl-2,15,19,20,23,25-hexazapentacyclo[15.5.2.17,11.02,6.020,24]pentacosa-1(23),7,9,11(25),17(24),18,21-heptaen-16-one |
| SMILES | CC1CCc2cc(F)cc(n2)C2CCCN2c2ccn3ncc(c3n2)C(=O)N1 |
| InChI | InChI=1S/C20H21FN6O/c1-12-4-5-14-9-13(21)10-16(24-14)17-3-2-7-26(17)18-6-8-27-19(25-18)15(11-22-27)20(28)23-12/h6,8-12,17H,2-5,7H2,1H3,(H,23,28) |
| InChIKey | WWPWNMDOFHCAMG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |