C21H24N6O — CID 142573846
9,15-dimethyl-2,11,16,20,21,24-hexazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaen-17-one (PubChem CID 142573846) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 9,15-dimethyl-2,11,16,20,21,24-hexazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaen-17-one.
| Compound Name | 9,15-dimethyl-2,11,16,20,21,24-hexazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaen-17-one |
|---|---|
| PubChem CID | 142573846 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 9,15-dimethyl-2,11,16,20,21,24-hexazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaen-17-one |
| SMILES | Cc1cnc2c(c1)C1CCCN1c1ccn3ncc(c3n1)C(=O)NC(C)CC2 |
| InChI | InChI=1S/C21H24N6O/c1-13-10-15-17(22-11-13)6-5-14(2)24-21(28)16-12-23-27-9-7-19(25-20(16)27)26-8-3-4-18(15)26/h7,9-12,14,18H,3-6,8H2,1-2H3,(H,24,28) |
| InChIKey | GQWFAWJUVDRKSP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |