C22H26N6O — CID 134468302
16,16-dimethyl-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one (PubChem CID 134468302) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 16,16-dimethyl-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one.
| Compound Name | 16,16-dimethyl-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one |
|---|---|
| PubChem CID | 134468302 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 16,16-dimethyl-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one |
| SMILES | CC1(C)CCCc2ncccc2C2CCCN2c2ccn3ncc(c3n2)C(=O)N1 |
| InChI | InChI=1S/C22H26N6O/c1-22(2)10-3-7-17-15(6-4-11-23-17)18-8-5-12-27(18)19-9-13-28-20(25-19)16(14-24-28)21(29)26-22/h4,6,9,11,13-14,18H,3,5,7-8,10,12H2,1-2H3,(H,26,29) |
| InChIKey | PBIYCGCWDDDZKP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |