C21H24FN7O — CID 167251228
(14S)-15-ethyl-9-fluoro-14-methyl-2,11,15,16,20,21,24-heptazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaen-17-one (PubChem CID 167251228) has the molecular formula C21H24FN7O and a molecular weight of 409.47 g/mol. Its IUPAC name is (14S)-15-ethyl-9-fluoro-14-methyl-2,11,15,16,20,21,24-heptazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaen-17-one.
| Compound Name | (14S)-15-ethyl-9-fluoro-14-methyl-2,11,15,16,20,21,24-heptazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaen-17-one |
|---|---|
| PubChem CID | 167251228 |
| Molecular Formula | C21H24FN7O |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (14S)-15-ethyl-9-fluoro-14-methyl-2,11,15,16,20,21,24-heptazapentacyclo[16.5.2.02,6.07,12.021,25]pentacosa-1(24),7(12),8,10,18(25),19,22-heptaen-17-one |
| SMILES | CCN1NC(=O)c2cnn3ccc(nc23)N2CCCC2c2cc(F)cnc2C[C@@H]1C |
| InChI | InChI=1S/C21H24FN7O/c1-3-28-13(2)9-17-15(10-14(22)11-23-17)18-5-4-7-27(18)19-6-8-29-20(25-19)16(12-24-29)21(30)26-28/h6,8,10-13,18H,3-5,7,9H2,1-2H3,(H,26,30)/t13-,18?/m0/s1 |
| InChIKey | YMDACBYDMPIIQJ-FVRDMJKUSA-N |
| XLogP | 2.52 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|