C23H23FN6O2 — CID 167251916
(6R,14R)-9-fluoro-15-methylidene-16-oxa-2,19,20,24,25,28-hexazahexacyclo[20.5.2.02,6.07,12.014,19.025,29]nonacosa-1(28),7(12),8,10,22(29),23,26-heptaen-21-one (PubChem CID 167251916) has the molecular formula C23H23FN6O2 and a molecular weight of 434.48 g/mol. Its IUPAC name is (6R,14R)-9-fluoro-15-methylidene-16-oxa-2,19,20,24,25,28-hexazahexacyclo[20.5.2.02,6.07,12.014,19.025,29]nonacosa-1(28),7(12),8,10,22(29),23,26-heptaen-21-one.
| Compound Name | (6R,14R)-9-fluoro-15-methylidene-16-oxa-2,19,20,24,25,28-hexazahexacyclo[20.5.2.02,6.07,12.014,19.025,29]nonacosa-1(28),7(12),8,10,22(29),23,26-heptaen-21-one |
|---|---|
| PubChem CID | 167251916 |
| Molecular Formula | C23H23FN6O2 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (6R,14R)-9-fluoro-15-methylidene-16-oxa-2,19,20,24,25,28-hexazahexacyclo[20.5.2.02,6.07,12.014,19.025,29]nonacosa-1(28),7(12),8,10,22(29),23,26-heptaen-21-one |
| SMILES | C=C1OCCN2NC(=O)c3cnn4ccc(nc34)N3CCC[C@@H]3c3cc(F)ccc3C[C@H]12 |
| InChI | InChI=1S/C23H23FN6O2/c1-14-20-11-15-4-5-16(24)12-17(15)19-3-2-7-28(19)21-6-8-30-22(26-21)18(13-25-30)23(31)27-29(20)9-10-32-14/h4-6,8,12-13,19-20H,1-3,7,9-11H2,(H,27,31)/t19-,20-/m1/s1 |
| InChIKey | NPCFZINOMBPCQQ-WOJBJXKFSA-N |
| XLogP | 2.63 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|