C38H43N5O10 — CID 142339559
1-carboxyoxyethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate (PubChem CID 142339559) has the molecular formula C38H43N5O10 and a molecular weight of 729.79 g/mol. Its IUPAC name is 1-carboxyoxyethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate.
| Compound Name | 1-carboxyoxyethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 142339559 |
| Molecular Formula | C38H43N5O10 |
| Molecular Weight | 729.79 g/mol |
| Exact Mass | 729.30 |
| IUPAC Name | 1-carboxyoxyethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-(N-hexoxycarbonylcarbamimidoyl)phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate |
| SMILES | [H]/N=C(\NC(=O)OCCCCCC)c1ccc(NC(=O)c2cc(C=C)c(OC)cc2-c2ccc(C(=O)NCC3CC3)nc2C(=O)OC(C)OC(=O)O)cc1 |
| InChI | InChI=1S/C38H43N5O10/c1-5-7-8-9-18-51-37(47)43-33(39)25-12-14-26(15-13-25)41-34(44)29-19-24(6-2)31(50-4)20-28(29)27-16-17-30(35(45)40-21-23-10-11-23)42-32(27)36(46)52-22(3)53-38(48)49/h6,12-17,19-20,22-23H,2,5,7-11,18,21H2,1,3-4H3,(H,40,45)(H,41,44)(H,48,49)(H2,39,43,47) |
| InChIKey | GTXFCCGOMXZLGH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 215.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.79 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|