C13H27N3 — CID 142339777
N'-ethyl-N'-[(E)-2-ethyl-4-ethyliminobut-2-enyl]-N-methylethane-1,2-diamine (PubChem CID 142339777) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is N'-ethyl-N'-[(E)-2-ethyl-4-ethyliminobut-2-enyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[(E)-2-ethyl-4-ethyliminobut-2-enyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 142339777 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | N'-ethyl-N'-[(E)-2-ethyl-4-ethyliminobut-2-enyl]-N-methylethane-1,2-diamine |
| SMILES | CC/N=C/C=C(\CC)CN(CC)CCNC |
| InChI | InChI=1S/C13H27N3/c1-5-13(8-9-15-6-2)12-16(7-3)11-10-14-4/h8-9,14H,5-7,10-12H2,1-4H3/b13-8+,15-9+ |
| InChIKey | GWCOUWSLCQSAEU-TVXJZBATSA-N |
| XLogP | 1.95 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|