C18H16Cl3N3O2S — CID 142342342
2-chloro-5-methoxybenzenethiol;5-(3,5-dichlorophenyl)-1-methylpyrazole-3-carboxamide (PubChem CID 142342342) has the molecular formula C18H16Cl3N3O2S and a molecular weight of 444.77 g/mol. Its IUPAC name is 2-chloro-5-methoxybenzenethiol;5-(3,5-dichlorophenyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | 2-chloro-5-methoxybenzenethiol;5-(3,5-dichlorophenyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142342342 |
| Molecular Formula | C18H16Cl3N3O2S |
| Molecular Weight | 444.77 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 2-chloro-5-methoxybenzenethiol;5-(3,5-dichlorophenyl)-1-methylpyrazole-3-carboxamide |
| SMILES | COc1ccc(Cl)c(S)c1.Cn1nc(C(N)=O)cc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2N3O.C7H7ClOS/c1-16-10(5-9(15-16)11(14)17)6-2-7(12)4-8(13)3-6;1-9-5-2-3-6(8)7(10)4-5/h2-5H,1H3,(H2,14,17);2-4,10H,1H3 |
| InChIKey | RAOPTJGGCFWJRZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.77 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|