C17H13F3N3OP — CID 142342388
N-phenyl-1-[3-phosphanyl-5-(trifluoromethyl)phenyl]imidazole-4-carboxamide (PubChem CID 142342388) has the molecular formula C17H13F3N3OP and a molecular weight of 363.28 g/mol. Its IUPAC name is N-phenyl-1-[3-phosphanyl-5-(trifluoromethyl)phenyl]imidazole-4-carboxamide.
| Compound Name | N-phenyl-1-[3-phosphanyl-5-(trifluoromethyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 142342388 |
| Molecular Formula | C17H13F3N3OP |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-phenyl-1-[3-phosphanyl-5-(trifluoromethyl)phenyl]imidazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cn(-c2cc(P)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C17H13F3N3OP/c18-17(19,20)11-6-13(8-14(25)7-11)23-9-15(21-10-23)16(24)22-12-4-2-1-3-5-12/h1-10H,25H2,(H,22,24) |
| InChIKey | QVRRLCHKSKXYJQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|