C17H11BrF3N3O3S — CID 139453195
N-(benzenesulfonyl)-1-[3-bromo-5-(trifluoromethyl)phenyl]imidazole-4-carboxamide (PubChem CID 139453195) has the molecular formula C17H11BrF3N3O3S and a molecular weight of 474.26 g/mol. Its IUPAC name is N-(benzenesulfonyl)-1-[3-bromo-5-(trifluoromethyl)phenyl]imidazole-4-carboxamide.
| Compound Name | N-(benzenesulfonyl)-1-[3-bromo-5-(trifluoromethyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 139453195 |
| Molecular Formula | C17H11BrF3N3O3S |
| Molecular Weight | 474.26 g/mol |
| Exact Mass | 472.97 |
| IUPAC Name | N-(benzenesulfonyl)-1-[3-bromo-5-(trifluoromethyl)phenyl]imidazole-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)c1cn(-c2cc(Br)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C17H11BrF3N3O3S/c18-12-6-11(17(19,20)21)7-13(8-12)24-9-15(22-10-24)16(25)23-28(26,27)14-4-2-1-3-5-14/h1-10H,(H,23,25) |
| InChIKey | VTDWTDAUAJPZCI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |