C16H11Cl2N3O3S — CID 139453021
N-(benzenesulfonyl)-1-(3,5-dichlorophenyl)imidazole-4-carboxamide (PubChem CID 139453021) has the molecular formula C16H11Cl2N3O3S and a molecular weight of 396.26 g/mol. Its IUPAC name is N-(benzenesulfonyl)-1-(3,5-dichlorophenyl)imidazole-4-carboxamide.
| Compound Name | N-(benzenesulfonyl)-1-(3,5-dichlorophenyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 139453021 |
| Molecular Formula | C16H11Cl2N3O3S |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | N-(benzenesulfonyl)-1-(3,5-dichlorophenyl)imidazole-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)c1cn(-c2cc(Cl)cc(Cl)c2)cn1 |
| InChI | InChI=1S/C16H11Cl2N3O3S/c17-11-6-12(18)8-13(7-11)21-9-15(19-10-21)16(22)20-25(23,24)14-4-2-1-3-5-14/h1-10H,(H,20,22) |
| InChIKey | FFQWFHRMVBPJMZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |