C16H9BrCl3N3O3S — CID 139453276
1-(4-bromo-3,5-dichlorophenyl)-N-(2-chlorophenyl)sulfonylimidazole-4-carboxamide (PubChem CID 139453276) has the molecular formula C16H9BrCl3N3O3S and a molecular weight of 509.60 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dichlorophenyl)-N-(2-chlorophenyl)sulfonylimidazole-4-carboxamide.
| Compound Name | 1-(4-bromo-3,5-dichlorophenyl)-N-(2-chlorophenyl)sulfonylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 139453276 |
| Molecular Formula | C16H9BrCl3N3O3S |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 506.86 |
| IUPAC Name | 1-(4-bromo-3,5-dichlorophenyl)-N-(2-chlorophenyl)sulfonylimidazole-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1Cl)c1cn(-c2cc(Cl)c(Br)c(Cl)c2)cn1 |
| InChI | InChI=1S/C16H9BrCl3N3O3S/c17-15-11(19)5-9(6-12(15)20)23-7-13(21-8-23)16(24)22-27(25,26)14-4-2-1-3-10(14)18/h1-8H,(H,22,24) |
| InChIKey | MRURFJHVPNCKOU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|