C16H10Cl3N3O3S — CID 139453257
N-(benzenesulfonyl)-1-(3,4,5-trichlorophenyl)imidazole-4-carboxamide (PubChem CID 139453257) has the molecular formula C16H10Cl3N3O3S and a molecular weight of 430.70 g/mol. Its IUPAC name is N-(benzenesulfonyl)-1-(3,4,5-trichlorophenyl)imidazole-4-carboxamide.
| Compound Name | N-(benzenesulfonyl)-1-(3,4,5-trichlorophenyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 139453257 |
| Molecular Formula | C16H10Cl3N3O3S |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | N-(benzenesulfonyl)-1-(3,4,5-trichlorophenyl)imidazole-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)c1cn(-c2cc(Cl)c(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C16H10Cl3N3O3S/c17-12-6-10(7-13(18)15(12)19)22-8-14(20-9-22)16(23)21-26(24,25)11-4-2-1-3-5-11/h1-9H,(H,21,23) |
| InChIKey | VKFAZJSJIFSCTJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|