C10H10ClN — CID 142342570
7-chloro-4-methyl-2,3-dihydroquinoline (PubChem CID 142342570) has the molecular formula C10H10ClN and a molecular weight of 179.65 g/mol. Its IUPAC name is 7-chloro-4-methyl-2,3-dihydroquinoline.
| Compound Name | 7-chloro-4-methyl-2,3-dihydroquinoline |
|---|---|
| PubChem CID | 142342570 |
| Molecular Formula | C10H10ClN |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 7-chloro-4-methyl-2,3-dihydroquinoline |
| SMILES | CC1=c2ccc(Cl)cc2=NCC1 |
| InChI | InChI=1S/C10H10ClN/c1-7-4-5-12-10-6-8(11)2-3-9(7)10/h2-3,6H,4-5H2,1H3 |
| InChIKey | GTDRBIYPFLSGQQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |