C44H39N2SSi+ — CID 142343015
methyl-[4-(N-[6-(N-(4-trimethylsilylphenyl)anilino)pyren-1-yl]anilino)phenyl]sulfanium (PubChem CID 142343015) has the molecular formula C44H39N2SSi+ and a molecular weight of 655.96 g/mol. Its IUPAC name is methyl-[4-(N-[6-(N-(4-trimethylsilylphenyl)anilino)pyren-1-yl]anilino)phenyl]sulfanium.
| Compound Name | methyl-[4-(N-[6-(N-(4-trimethylsilylphenyl)anilino)pyren-1-yl]anilino)phenyl]sulfanium |
|---|---|
| PubChem CID | 142343015 |
| Molecular Formula | C44H39N2SSi+ |
| Molecular Weight | 655.96 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | methyl-[4-(N-[6-(N-(4-trimethylsilylphenyl)anilino)pyren-1-yl]anilino)phenyl]sulfanium |
| SMILES | C[SH+]c1ccc(N(c2ccccc2)c2ccc3ccc4c(N(c5ccccc5)c5ccc([Si](C)(C)C)cc5)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C44H38N2SSi/c1-47-37-23-19-35(20-24-37)45(33-11-7-5-8-12-33)41-29-17-31-16-28-40-42(30-18-32-15-27-39(41)43(31)44(32)40)46(34-13-9-6-10-14-34)36-21-25-38(26-22-36)48(2,3)4/h5-30H,1-4H3/p+1 |
| InChIKey | HEVBOVPVOINZCS-UHFFFAOYSA-O |
| XLogP | 11.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.96 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|