C32H26N2Si — CID 59592475
N-(4-isocyanophenyl)-N-(4-trimethylsilylphenyl)pyren-1-amine (PubChem CID 59592475) has the molecular formula C32H26N2Si and a molecular weight of 466.66 g/mol. Its IUPAC name is N-(4-isocyanophenyl)-N-(4-trimethylsilylphenyl)pyren-1-amine.
| Compound Name | N-(4-isocyanophenyl)-N-(4-trimethylsilylphenyl)pyren-1-amine |
|---|---|
| PubChem CID | 59592475 |
| Molecular Formula | C32H26N2Si |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-(4-isocyanophenyl)-N-(4-trimethylsilylphenyl)pyren-1-amine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc([Si](C)(C)C)cc2)c2ccc3ccc4cccc5ccc2c3c45)cc1 |
| InChI | InChI=1S/C32H26N2Si/c1-33-25-12-14-26(15-13-25)34(27-16-18-28(19-17-27)35(2,3)4)30-21-11-24-9-8-22-6-5-7-23-10-20-29(30)32(24)31(22)23/h5-21H,2-4H3 |
| InChIKey | OCMACRBJMODZFJ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|