C39H25N3 — CID 123464650
N-(4-isocyanophenyl)-15-phenyl-N-(4-phenylphenyl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine (PubChem CID 123464650) has the molecular formula C39H25N3 and a molecular weight of 535.65 g/mol. Its IUPAC name is N-(4-isocyanophenyl)-15-phenyl-N-(4-phenylphenyl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine.
| Compound Name | N-(4-isocyanophenyl)-15-phenyl-N-(4-phenylphenyl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine |
|---|---|
| PubChem CID | 123464650 |
| Molecular Formula | C39H25N3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | N-(4-isocyanophenyl)-15-phenyl-N-(4-phenylphenyl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc3c4c2ccc2cccc(c24)n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C39H25N3/c1-40-30-18-22-33(23-19-30)41(32-20-15-28(16-21-32)27-9-4-2-5-10-27)35-25-26-37-39-34(35)24-17-29-11-8-14-36(38(29)39)42(37)31-12-6-3-7-13-31/h2-26H |
| InChIKey | XQKLNPAARILFDH-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|