C35H21N5 — CID 140732114
N-(4-isocyanophenyl)-15-phenyl-N-quinoxalin-5-yl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine (PubChem CID 140732114) has the molecular formula C35H21N5 and a molecular weight of 511.59 g/mol. Its IUPAC name is N-(4-isocyanophenyl)-15-phenyl-N-quinoxalin-5-yl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine.
| Compound Name | N-(4-isocyanophenyl)-15-phenyl-N-quinoxalin-5-yl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine |
|---|---|
| PubChem CID | 140732114 |
| Molecular Formula | C35H21N5 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | N-(4-isocyanophenyl)-15-phenyl-N-quinoxalin-5-yl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc3c4c2ccc2cccc(c24)n3-c2ccccc2)c2cccc3nccnc23)cc1 |
| InChI | InChI=1S/C35H21N5/c1-36-24-14-16-26(17-15-24)39(32-12-6-10-28-35(32)38-22-21-37-28)29-19-20-31-34-27(29)18-13-23-7-5-11-30(33(23)34)40(31)25-8-3-2-4-9-25/h2-22H |
| InChIKey | TUGIZRIWNWKBOV-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 38.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|