C33H21N3 — CID 140732093
N-(4-isocyanophenyl)-N-(2,3,4,5,6-pentadeuteriophenyl)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine (PubChem CID 140732093) has the molecular formula C33H21N3 and a molecular weight of 464.58 g/mol. Its IUPAC name is N-(4-isocyanophenyl)-N-(2,3,4,5,6-pentadeuteriophenyl)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine.
| Compound Name | N-(4-isocyanophenyl)-N-(2,3,4,5,6-pentadeuteriophenyl)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine |
|---|---|
| PubChem CID | 140732093 |
| Molecular Formula | C33H21N3 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-(4-isocyanophenyl)-N-(2,3,4,5,6-pentadeuteriophenyl)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccc([N+]#[C-])cc2)c2ccc3c4c2ccc2cccc(c24)n3-c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C33H21N3/c1-34-24-16-18-27(19-17-24)35(25-10-4-2-5-11-25)29-21-22-31-33-28(29)20-15-23-9-8-14-30(32(23)33)36(31)26-12-6-3-7-13-26/h2-22H/i2D,4D,5D,10D,11D |
| InChIKey | FWTMYINTRUFWFN-COTXDTRDSA-N |
| XLogP | 9.40 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|