C54H58N4Si4 — CID 59592478
1-N,6-N-bis[3,5-bis(trimethylsilyl)phenyl]-1-N,6-N-bis(4-isocyanophenyl)pyrene-1,6-diamine (PubChem CID 59592478) has the molecular formula C54H58N4Si4 and a molecular weight of 875.43 g/mol. Its IUPAC name is 1-N,6-N-bis[3,5-bis(trimethylsilyl)phenyl]-1-N,6-N-bis(4-isocyanophenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[3,5-bis(trimethylsilyl)phenyl]-1-N,6-N-bis(4-isocyanophenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 59592478 |
| Molecular Formula | C54H58N4Si4 |
| Molecular Weight | 875.43 g/mol |
| Exact Mass | 874.37 |
| IUPAC Name | 1-N,6-N-bis[3,5-bis(trimethylsilyl)phenyl]-1-N,6-N-bis(4-isocyanophenyl)pyrene-1,6-diamine |
| SMILES | [C-]#[N+]c1ccc(N(c2cc([Si](C)(C)C)cc([Si](C)(C)C)c2)c2ccc3ccc4c(N(c5ccc([N+]#[C-])cc5)c5cc([Si](C)(C)C)cc([Si](C)(C)C)c5)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C54H58N4Si4/c1-55-39-19-23-41(24-20-39)57(43-31-45(59(3,4)5)35-46(32-43)60(6,7)8)51-29-17-37-16-28-50-52(30-18-38-15-27-49(51)53(37)54(38)50)58(42-25-21-40(56-2)22-26-42)44-33-47(61(9,10)11)36-48(34-44)62(12,13)14/h15-36H,3-14H3 |
| InChIKey | MYGNFZAIOASMBM-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 15.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.43 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|