C48H42N4Si2 — CID 59592451
1-N,6-N-bis(4-isocyanophenyl)-1-N,6-N-bis(2-trimethylsilylphenyl)pyrene-1,6-diamine (PubChem CID 59592451) has the molecular formula C48H42N4Si2 and a molecular weight of 731.06 g/mol. Its IUPAC name is 1-N,6-N-bis(4-isocyanophenyl)-1-N,6-N-bis(2-trimethylsilylphenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(4-isocyanophenyl)-1-N,6-N-bis(2-trimethylsilylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 59592451 |
| Molecular Formula | C48H42N4Si2 |
| Molecular Weight | 731.06 g/mol |
| Exact Mass | 730.29 |
| IUPAC Name | 1-N,6-N-bis(4-isocyanophenyl)-1-N,6-N-bis(2-trimethylsilylphenyl)pyrene-1,6-diamine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccccc2[Si](C)(C)C)c2ccc3ccc4c(N(c5ccc([N+]#[C-])cc5)c5ccccc5[Si](C)(C)C)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C48H42N4Si2/c1-49-35-21-25-37(26-22-35)51(43-13-9-11-15-45(43)53(3,4)5)41-31-19-33-18-30-40-42(32-20-34-17-29-39(41)47(33)48(34)40)52(38-27-23-36(50-2)24-28-38)44-14-10-12-16-46(44)54(6,7)8/h9-32H,3-8H3 |
| InChIKey | BUEPALIXKZGUIN-UHFFFAOYSA-N |
| XLogP | 13.72 |
| TPSA | 15.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.06 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|