C46H33N5Si — CID 59592441
2-(2-isocyano-N-[6-(2-isocyano-N-(2-trimethylsilylphenyl)anilino)pyren-1-yl]anilino)benzonitrile (PubChem CID 59592441) has the molecular formula C46H33N5Si and a molecular weight of 683.89 g/mol. Its IUPAC name is 2-(2-isocyano-N-[6-(2-isocyano-N-(2-trimethylsilylphenyl)anilino)pyren-1-yl]anilino)benzonitrile.
| Compound Name | 2-(2-isocyano-N-[6-(2-isocyano-N-(2-trimethylsilylphenyl)anilino)pyren-1-yl]anilino)benzonitrile |
|---|---|
| PubChem CID | 59592441 |
| Molecular Formula | C46H33N5Si |
| Molecular Weight | 683.89 g/mol |
| Exact Mass | 683.25 |
| IUPAC Name | 2-(2-isocyano-N-[6-(2-isocyano-N-(2-trimethylsilylphenyl)anilino)pyren-1-yl]anilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1N(c1ccccc1C#N)c1ccc2ccc3c(N(c4ccccc4[N+]#[C-])c4ccccc4[Si](C)(C)C)ccc4ccc1c2c43 |
| InChI | InChI=1S/C46H33N5Si/c1-48-36-15-7-10-18-41(36)50(38-17-9-6-14-33(38)30-47)39-28-24-31-23-27-35-40(29-25-32-22-26-34(39)45(31)46(32)35)51(42-19-11-8-16-37(42)49-2)43-20-12-13-21-44(43)52(3,4)5/h6-29H,3-5H3 |
| InChIKey | KCYHMNOQFWUHLN-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.89 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|